Combi Class |
Namespace: Scilligence.MolEngine
public class Combi : LicensedObject
The Combi type exposes the following members.
| Name | Description | |
|---|---|---|
| Components |
| Name | Description | |
|---|---|---|
| Enumerate | ||
| EnumNext | ||
| Equals | (Inherited from Object.) | |
| Finalize | Allows an object to try to free resources and perform other cleanup operations before it is reclaimed by garbage collection. (Inherited from Object.) | |
| GetHashCode | Serves as a hash function for a particular type. (Inherited from Object.) | |
| GetType | Gets the Type of the current instance. (Inherited from Object.) | |
| MemberwiseClone | Creates a shallow copy of the current Object. (Inherited from Object.) | |
| ResetEnum | ||
| ToString | Returns a string that represents the current object. (Inherited from Object.) |
// read combi enumeration rule from a reaction Reaction rule = Reaction.ReadSMILES("[R1]C.[R2]O.[R3]c1ncccc1>>[R3]c1nc(C[R1])cc(O[R2])c1"); rule.Cleanup(); // generate coordinates rule.SaveImage("C:\\temp\\rule.png"); // prepare reagents Molecule r1_1 = Molecule.ReadSMILES("BrC"); Molecule r2_1 = Molecule.ReadSMILES("CCO"); Molecule r3_1 = Molecule.ReadSMILES("Nc1ncccc1"); // combi Combi combi = new Combi(rule); Reaction result = combi.Enumerate(new Molecule[] { r1_1, r2_1, r3_1 }); result.Cleanup(); result.SaveImage("c:\\temp\\result.png");